C19H17F4N3O5S — CID 155257996
(3S)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(2-hydroxybut-3-yn-2-yl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 155257996) has the molecular formula C19H17F4N3O5S and a molecular weight of 475.42 g/mol. Its IUPAC name is (3S)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(2-hydroxybut-3-yn-2-yl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3S)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(2-hydroxybut-3-yn-2-yl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 155257996 |
| Molecular Formula | C19H17F4N3O5S |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (3S)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(2-hydroxybut-3-yn-2-yl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | C#CC(C)(O)[C@@H]1COc2c(cn(C)c2C(=O)Nc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C19H17F4N3O5S/c1-4-18(2,28)14-9-31-16-13(32(29,30)25-14)8-26(3)15(16)17(27)24-10-5-6-12(20)11(7-10)19(21,22)23/h1,5-8,14,25,28H,9H2,2-3H3,(H,24,27)/t14-,18?/m0/s1 |
| InChIKey | RCGBJGOKLQHKSU-PIVQAISJSA-N |
| XLogP | 1.86 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|