C21H21FN4O6S — CID 155258035
(3S)-N-(3-cyano-4-fluorophenyl)-3-[(1R)-1,4-dihydroxy-4-methylpent-2-ynyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 155258035) has the molecular formula C21H21FN4O6S and a molecular weight of 476.49 g/mol. Its IUPAC name is (3S)-N-(3-cyano-4-fluorophenyl)-3-[(1R)-1,4-dihydroxy-4-methylpent-2-ynyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3S)-N-(3-cyano-4-fluorophenyl)-3-[(1R)-1,4-dihydroxy-4-methylpent-2-ynyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 155258035 |
| Molecular Formula | C21H21FN4O6S |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | (3S)-N-(3-cyano-4-fluorophenyl)-3-[(1R)-1,4-dihydroxy-4-methylpent-2-ynyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(C#N)c1)OC[C@@H]([C@H](O)C#CC(C)(C)O)NS2(=O)=O |
| InChI | InChI=1S/C21H21FN4O6S/c1-21(2,29)7-6-16(27)15-11-32-19-17(33(30,31)25-15)10-26(3)18(19)20(28)24-13-4-5-14(22)12(8-13)9-23/h4-5,8,10,15-16,25,27,29H,11H2,1-3H3,(H,24,28)/t15-,16+/m0/s1 |
| InChIKey | XCAQJVHGMAGXQI-JKSUJKDBSA-N |
| XLogP | 0.46 |
| TPSA | 153.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|