C17H17FN4O4S — CID 155062099
5-[[(3-ethenyl-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepin-6-yl)-hydroxymethyl]amino]-2-fluorobenzonitrile (PubChem CID 155062099) has the molecular formula C17H17FN4O4S and a molecular weight of 392.41 g/mol. Its IUPAC name is 5-[[(3-ethenyl-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepin-6-yl)-hydroxymethyl]amino]-2-fluorobenzonitrile.
| Compound Name | 5-[[(3-ethenyl-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepin-6-yl)-hydroxymethyl]amino]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 155062099 |
| Molecular Formula | C17H17FN4O4S |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 5-[[(3-ethenyl-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepin-6-yl)-hydroxymethyl]amino]-2-fluorobenzonitrile |
| SMILES | C=CC1COc2c(cn(C)c2C(O)Nc2ccc(F)c(C#N)c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C17H17FN4O4S/c1-3-11-9-26-16-14(27(24,25)21-11)8-22(2)15(16)17(23)20-12-4-5-13(18)10(6-12)7-19/h3-6,8,11,17,20-21,23H,1,9H2,2H3 |
| InChIKey | PQHADLGGYDRSLT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|