C18H20F3N3O5S — CID 139471244
cyclopropyl-[(3R)-6-[hydroxy-(3,4,5-trifluoroanilino)methyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepin-3-yl]methanol (PubChem CID 139471244) has the molecular formula C18H20F3N3O5S and a molecular weight of 447.44 g/mol. Its IUPAC name is cyclopropyl-[(3R)-6-[hydroxy-(3,4,5-trifluoroanilino)methyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepin-3-yl]methanol.
| Compound Name | cyclopropyl-[(3R)-6-[hydroxy-(3,4,5-trifluoroanilino)methyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepin-3-yl]methanol |
|---|---|
| PubChem CID | 139471244 |
| Molecular Formula | C18H20F3N3O5S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | cyclopropyl-[(3R)-6-[hydroxy-(3,4,5-trifluoroanilino)methyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepin-3-yl]methanol |
| SMILES | Cn1cc2c(c1C(O)Nc1cc(F)c(F)c(F)c1)OC[C@H](C(O)C1CC1)NS2(=O)=O |
| InChI | InChI=1S/C18H20F3N3O5S/c1-24-6-13-17(29-7-12(23-30(13,27)28)16(25)8-2-3-8)15(24)18(26)22-9-4-10(19)14(21)11(20)5-9/h4-6,8,12,16,18,22-23,25-26H,2-3,7H2,1H3/t12-,16?,18?/m1/s1 |
| InChIKey | FCQPQHSKCDEMCF-YAJMATIESA-N |
| XLogP | 1.36 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|