C19H23F3N4O2S — CID 166839024
[(3R)-3-(cyclopropylmethyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]-(3,4,5-trifluoroanilino)methanol (PubChem CID 166839024) has the molecular formula C19H23F3N4O2S and a molecular weight of 428.48 g/mol. Its IUPAC name is [(3R)-3-(cyclopropylmethyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]-(3,4,5-trifluoroanilino)methanol.
| Compound Name | [(3R)-3-(cyclopropylmethyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]-(3,4,5-trifluoroanilino)methanol |
|---|---|
| PubChem CID | 166839024 |
| Molecular Formula | C19H23F3N4O2S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [(3R)-3-(cyclopropylmethyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]-(3,4,5-trifluoroanilino)methanol |
| SMILES | [H]N=S1(=O)N[C@@H](CC2CC2)CCc2c1cn(C)c2C(O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H23F3N4O2S/c1-26-9-16-13(5-4-11(6-10-2-3-10)25-29(16,23)28)18(26)19(27)24-12-7-14(20)17(22)15(21)8-12/h7-11,19,24,27H,2-6H2,1H3,(H2,23,25,28)/t11-,19?,29?/m1/s1 |
| InChIKey | IADQMWMFJINVCJ-LQZYQFFBSA-N |
| XLogP | 3.57 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|