C17H21F2N5O3S — CID 166839015
1-[(3R)-6-[[[2-(difluoromethyl)-4-pyridinyl]amino]-hydroxymethyl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-3-yl]ethenol (PubChem CID 166839015) has the molecular formula C17H21F2N5O3S and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-[(3R)-6-[[[2-(difluoromethyl)-4-pyridinyl]amino]-hydroxymethyl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-3-yl]ethenol.
| Compound Name | 1-[(3R)-6-[[[2-(difluoromethyl)-4-pyridinyl]amino]-hydroxymethyl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-3-yl]ethenol |
|---|---|
| PubChem CID | 166839015 |
| Molecular Formula | C17H21F2N5O3S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-[(3R)-6-[[[2-(difluoromethyl)-4-pyridinyl]amino]-hydroxymethyl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-3-yl]ethenol |
| SMILES | [H]N=S1(=O)N[C@@H](C(=C)O)CCc2c1cn(C)c2C(O)Nc1ccnc(C(F)F)c1 |
| InChI | InChI=1S/C17H21F2N5O3S/c1-9(25)12-4-3-11-14(28(20,27)23-12)8-24(2)15(11)17(26)22-10-5-6-21-13(7-10)16(18)19/h5-8,12,16-17,25-26H,1,3-4H2,2H3,(H,21,22)(H2,20,23,27)/t12-,17?,28?/m1/s1 |
| InChIKey | SIYAOKACJFCFAA-YBXGIDOYSA-N |
| XLogP | 2.76 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|