C27H26FN5O2S — CID 146608272
2-fluoro-5-[[hydroxy-[(3S)-1-imino-7-methyl-3-(naphthalen-2-ylmethyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]methyl]amino]benzonitrile (PubChem CID 146608272) has the molecular formula C27H26FN5O2S and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-fluoro-5-[[hydroxy-[(3S)-1-imino-7-methyl-3-(naphthalen-2-ylmethyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]methyl]amino]benzonitrile.
| Compound Name | 2-fluoro-5-[[hydroxy-[(3S)-1-imino-7-methyl-3-(naphthalen-2-ylmethyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 146608272 |
| Molecular Formula | C27H26FN5O2S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 2-fluoro-5-[[hydroxy-[(3S)-1-imino-7-methyl-3-(naphthalen-2-ylmethyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]methyl]amino]benzonitrile |
| SMILES | [H]N=S1(=O)N[C@H](Cc2ccc3ccccc3c2)CCc2c1cn(C)c2C(O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C27H26FN5O2S/c1-33-16-25-23(26(33)27(34)31-21-9-11-24(28)20(14-21)15-29)10-8-22(32-36(25,30)35)13-17-6-7-18-4-2-3-5-19(18)12-17/h2-7,9,11-12,14,16,22,27,31,34H,8,10,13H2,1H3,(H2,30,32,35)/t22-,27?,36?/m0/s1 |
| InChIKey | IFLKVHGYBKTYFO-FYQRTBEISA-N |
| XLogP | 4.76 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|