C24H24FN5O2S — CID 167697025
(3R)-N-(3-cyano-4-fluorophenyl)-1-imino-7-methyl-3-[(4-methylphenyl)methyl]-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 167697025) has the molecular formula C24H24FN5O2S and a molecular weight of 465.55 g/mol. Its IUPAC name is (3R)-N-(3-cyano-4-fluorophenyl)-1-imino-7-methyl-3-[(4-methylphenyl)methyl]-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-N-(3-cyano-4-fluorophenyl)-1-imino-7-methyl-3-[(4-methylphenyl)methyl]-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 167697025 |
| Molecular Formula | C24H24FN5O2S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (3R)-N-(3-cyano-4-fluorophenyl)-1-imino-7-methyl-3-[(4-methylphenyl)methyl]-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@@H](Cc2ccc(C)cc2)CCc2c1cn(C)c2C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C24H24FN5O2S/c1-15-3-5-16(6-4-15)11-19-7-9-20-22(33(27,32)29-19)14-30(2)23(20)24(31)28-18-8-10-21(25)17(12-18)13-26/h3-6,8,10,12,14,19H,7,9,11H2,1-2H3,(H,28,31)(H2,27,29,32)/t19-,33?/m1/s1 |
| InChIKey | XUPWWBSNKAWQJC-SZFQZUEASA-N |
| XLogP | 4.06 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |