C26H25FN6O2S — CID 154991277
(3S)-N-(2-cyano-6-fluoro-4-pyridinyl)-3-(7,8-dihydronaphthalen-2-ylmethyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 154991277) has the molecular formula C26H25FN6O2S and a molecular weight of 504.59 g/mol. Its IUPAC name is (3S)-N-(2-cyano-6-fluoro-4-pyridinyl)-3-(7,8-dihydronaphthalen-2-ylmethyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3S)-N-(2-cyano-6-fluoro-4-pyridinyl)-3-(7,8-dihydronaphthalen-2-ylmethyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 154991277 |
| Molecular Formula | C26H25FN6O2S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (3S)-N-(2-cyano-6-fluoro-4-pyridinyl)-3-(7,8-dihydronaphthalen-2-ylmethyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@H](Cc2ccc3c(c2)CCC=C3)CCc2c1cn(C)c2C(=O)Nc1cc(F)nc(C#N)c1 |
| InChI | InChI=1S/C26H25FN6O2S/c1-33-15-23-22(25(33)26(34)31-20-12-21(14-28)30-24(27)13-20)9-8-19(32-36(23,29)35)11-16-6-7-17-4-2-3-5-18(17)10-16/h2,4,6-7,10,12-13,15,19H,3,5,8-9,11H2,1H3,(H2,29,32,35)(H,30,31,34)/t19-,36?/m0/s1 |
| InChIKey | DIPSQTIHTVTKME-VPTCXKPOSA-N |
| XLogP | 4.11 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|