C21H27FN6O2S — CID 166839017
4-[[[(3R)-3-cyclohexyl-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]-hydroxymethyl]amino]-6-fluoropyridine-2-carbonitrile (PubChem CID 166839017) has the molecular formula C21H27FN6O2S and a molecular weight of 446.55 g/mol. Its IUPAC name is 4-[[[(3R)-3-cyclohexyl-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]-hydroxymethyl]amino]-6-fluoropyridine-2-carbonitrile.
| Compound Name | 4-[[[(3R)-3-cyclohexyl-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]-hydroxymethyl]amino]-6-fluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 166839017 |
| Molecular Formula | C21H27FN6O2S |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-[[[(3R)-3-cyclohexyl-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepin-6-yl]-hydroxymethyl]amino]-6-fluoropyridine-2-carbonitrile |
| SMILES | [H]N=S1(=O)N[C@@H](C2CCCCC2)CCc2c1cn(C)c2C(O)Nc1cc(F)nc(C#N)c1 |
| InChI | InChI=1S/C21H27FN6O2S/c1-28-12-18-16(7-8-17(27-31(18,24)30)13-5-3-2-4-6-13)20(28)21(29)26-14-9-15(11-23)25-19(22)10-14/h9-10,12-13,17,21,29H,2-8H2,1H3,(H,25,26)(H2,24,27,30)/t17-,21?,31?/m1/s1 |
| InChIKey | POGMHLOKVBNEEP-YPIFFHBRSA-N |
| XLogP | 3.34 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|