C22H30F2N4O2S — CID 166839006
(3R)-3-cyclohexyl-N-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 166839006) has the molecular formula C22H30F2N4O2S and a molecular weight of 452.57 g/mol. Its IUPAC name is (3R)-3-cyclohexyl-N-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-3-cyclohexyl-N-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 166839006 |
| Molecular Formula | C22H30F2N4O2S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (3R)-3-cyclohexyl-N-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@@H](C2CCCCC2)CCc2c1cn(C)c2C(=O)NC(=C)/C=C(F)\C(F)=C/C |
| InChI | InChI=1S/C22H30F2N4O2S/c1-4-17(23)18(24)12-14(2)26-22(29)21-16-10-11-19(15-8-6-5-7-9-15)27-31(25,30)20(16)13-28(21)3/h4,12-13,15,19H,2,5-11H2,1,3H3,(H,26,29)(H2,25,27,30)/b17-4+,18-12+/t19-,31?/m1/s1 |
| InChIKey | WVMSBBOZKSCKFC-NXLKFJNFSA-N |
| XLogP | 4.80 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|