C22H20F4N4O2S — CID 154991305
(3R)-3-[(4-fluorophenyl)methyl]-1-imino-7-methyl-1-oxo-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 154991305) has the molecular formula C22H20F4N4O2S and a molecular weight of 480.49 g/mol. Its IUPAC name is (3R)-3-[(4-fluorophenyl)methyl]-1-imino-7-methyl-1-oxo-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-3-[(4-fluorophenyl)methyl]-1-imino-7-methyl-1-oxo-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 154991305 |
| Molecular Formula | C22H20F4N4O2S |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | (3R)-3-[(4-fluorophenyl)methyl]-1-imino-7-methyl-1-oxo-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@@H](Cc2ccc(F)cc2)CCc2c1cn(C)c2C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C22H20F4N4O2S/c1-30-11-19-16(21(30)22(31)28-15-9-17(24)20(26)18(25)10-15)7-6-14(29-33(19,27)32)8-12-2-4-13(23)5-3-12/h2-5,9-11,14H,6-8H2,1H3,(H,28,31)(H2,27,29,32)/t14-,33?/m1/s1 |
| InChIKey | DPEGTICFVPGUKV-PXYRPBPISA-N |
| XLogP | 4.30 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|