C24H27ClFN5O2S — CID 146607519
(3R)-N-(2-chloro-4-pyridinyl)-3-[(2S)-4-(4-fluorophenyl)butan-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 146607519) has the molecular formula C24H27ClFN5O2S and a molecular weight of 504.03 g/mol. Its IUPAC name is (3R)-N-(2-chloro-4-pyridinyl)-3-[(2S)-4-(4-fluorophenyl)butan-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-N-(2-chloro-4-pyridinyl)-3-[(2S)-4-(4-fluorophenyl)butan-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 146607519 |
| Molecular Formula | C24H27ClFN5O2S |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (3R)-N-(2-chloro-4-pyridinyl)-3-[(2S)-4-(4-fluorophenyl)butan-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@@H]([C@@H](C)CCc2ccc(F)cc2)CCc2c1cn(C)c2C(=O)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C24H27ClFN5O2S/c1-15(3-4-16-5-7-17(26)8-6-16)20-10-9-19-21(34(27,33)30-20)14-31(2)23(19)24(32)29-18-11-12-28-22(25)13-18/h5-8,11-15,20H,3-4,9-10H2,1-2H3,(H2,27,30,33)(H,28,29,32)/t15-,20+,34?/m0/s1 |
| InChIKey | JMJKELLKEYYSJH-RMQCIEDWSA-N |
| XLogP | 4.96 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|