C19H19FN4O5S — CID 154682328
N-(3-cyano-4-fluorophenyl)-3-(1-hydroxybut-3-enyl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 154682328) has the molecular formula C19H19FN4O5S and a molecular weight of 434.45 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-3-(1-hydroxybut-3-enyl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-3-(1-hydroxybut-3-enyl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 154682328 |
| Molecular Formula | C19H19FN4O5S |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-3-(1-hydroxybut-3-enyl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | C=CCC(O)C1COc2c(cn(C)c2C(=O)Nc2ccc(F)c(C#N)c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C19H19FN4O5S/c1-3-4-15(25)14-10-29-18-16(30(27,28)23-14)9-24(2)17(18)19(26)22-12-5-6-13(20)11(7-12)8-21/h3,5-7,9,14-15,23,25H,1,4,10H2,2H3,(H,22,26) |
| InChIKey | WOFHADCKJNSKDW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|