C19H16F7N3O5S — CID 154682066
(3R)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-7-methyl-1,1-dioxo-3-[(2S)-1,1,1-trifluoro-2-hydroxybut-3-en-2-yl]-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 154682066) has the molecular formula C19H16F7N3O5S and a molecular weight of 531.41 g/mol. Its IUPAC name is (3R)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-7-methyl-1,1-dioxo-3-[(2S)-1,1,1-trifluoro-2-hydroxybut-3-en-2-yl]-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3R)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-7-methyl-1,1-dioxo-3-[(2S)-1,1,1-trifluoro-2-hydroxybut-3-en-2-yl]-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 154682066 |
| Molecular Formula | C19H16F7N3O5S |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | (3R)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-7-methyl-1,1-dioxo-3-[(2S)-1,1,1-trifluoro-2-hydroxybut-3-en-2-yl]-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | C=C[C@](O)([C@H]1COc2c(cn(C)c2C(=O)Nc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)N1)C(F)(F)F |
| InChI | InChI=1S/C19H16F7N3O5S/c1-3-17(31,19(24,25)26)13-8-34-15-12(35(32,33)28-13)7-29(2)14(15)16(30)27-9-4-5-11(20)10(6-9)18(21,22)23/h3-7,13,28,31H,1,8H2,2H3,(H,27,30)/t13-,17+/m1/s1 |
| InChIKey | XGKNLUVXXYSXFK-DYVFJYSZSA-N |
| XLogP | 2.95 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|