C23H26N4O6S2 — CID 158947317
(3R)-N-(3-cyano-4-methylphenyl)-3-(4-ethenyl-1,1-dioxothian-4-yl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 158947317) has the molecular formula C23H26N4O6S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is (3R)-N-(3-cyano-4-methylphenyl)-3-(4-ethenyl-1,1-dioxothian-4-yl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3R)-N-(3-cyano-4-methylphenyl)-3-(4-ethenyl-1,1-dioxothian-4-yl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 158947317 |
| Molecular Formula | C23H26N4O6S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | (3R)-N-(3-cyano-4-methylphenyl)-3-(4-ethenyl-1,1-dioxothian-4-yl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | C=CC1([C@@H]2COc3c(cn(C)c3C(=O)Nc3ccc(C)c(C#N)c3)S(=O)(=O)N2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C23H26N4O6S2/c1-4-23(7-9-34(29,30)10-8-23)19-14-33-21-18(35(31,32)26-19)13-27(3)20(21)22(28)25-17-6-5-15(2)16(11-17)12-24/h4-6,11,13,19,26H,1,7-10,14H2,2-3H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | VINLRUYGHIAIDY-IBGZPJMESA-N |
| XLogP | 1.88 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|