C20H21FN4O4S — CID 154682292
N-(3-cyano-4-fluorophenyl)-3-[(4R)-4-hydroxyhex-5-enyl]-1-methyl-4-(methylideneamino)sulfonylpyrrole-2-carboxamide (PubChem CID 154682292) has the molecular formula C20H21FN4O4S and a molecular weight of 432.48 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-3-[(4R)-4-hydroxyhex-5-enyl]-1-methyl-4-(methylideneamino)sulfonylpyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-3-[(4R)-4-hydroxyhex-5-enyl]-1-methyl-4-(methylideneamino)sulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 154682292 |
| Molecular Formula | C20H21FN4O4S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-3-[(4R)-4-hydroxyhex-5-enyl]-1-methyl-4-(methylideneamino)sulfonylpyrrole-2-carboxamide |
| SMILES | C=C[C@H](O)CCCc1c(S(=O)(=O)N=C)cn(C)c1C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C20H21FN4O4S/c1-4-15(26)6-5-7-16-18(30(28,29)23-2)12-25(3)19(16)20(27)24-14-8-9-17(21)13(10-14)11-22/h4,8-10,12,15,26H,1-2,5-7H2,3H3,(H,24,27)/t15-/m0/s1 |
| InChIKey | RFMBSNAWNCPCER-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|