C20H21F4N3O5S — CID 155062075
N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(3-hydroxy-3-methylpent-4-enoxy)-1-methyl-4-(methylideneamino)sulfonylpyrrole-2-carboxamide (PubChem CID 155062075) has the molecular formula C20H21F4N3O5S and a molecular weight of 491.46 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(3-hydroxy-3-methylpent-4-enoxy)-1-methyl-4-(methylideneamino)sulfonylpyrrole-2-carboxamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(3-hydroxy-3-methylpent-4-enoxy)-1-methyl-4-(methylideneamino)sulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155062075 |
| Molecular Formula | C20H21F4N3O5S |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(3-hydroxy-3-methylpent-4-enoxy)-1-methyl-4-(methylideneamino)sulfonylpyrrole-2-carboxamide |
| SMILES | C=CC(C)(O)CCOc1c(S(=O)(=O)N=C)cn(C)c1C(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F4N3O5S/c1-5-19(2,29)8-9-32-17-15(33(30,31)25-3)11-27(4)16(17)18(28)26-12-6-7-14(21)13(10-12)20(22,23)24/h5-7,10-11,29H,1,3,8-9H2,2,4H3,(H,26,28) |
| InChIKey | RJDUOVACXRRXFW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|