C16H21NO4 — CID 102559005
[3-(methylcarbamoyl)phenyl] 3-(oxan-3-yl)propanoate (PubChem CID 102559005) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is [3-(methylcarbamoyl)phenyl] 3-(oxan-3-yl)propanoate.
| Compound Name | [3-(methylcarbamoyl)phenyl] 3-(oxan-3-yl)propanoate |
|---|---|
| PubChem CID | 102559005 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | [3-(methylcarbamoyl)phenyl] 3-(oxan-3-yl)propanoate |
| SMILES | CNC(=O)c1cccc(OC(=O)CCC2CCCOC2)c1 |
| InChI | InChI=1S/C16H21NO4/c1-17-16(19)13-5-2-6-14(10-13)21-15(18)8-7-12-4-3-9-20-11-12/h2,5-6,10,12H,3-4,7-9,11H2,1H3,(H,17,19) |
| InChIKey | YFKQXQODWNVKAQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|