C16H23N5O2S — CID 102559364
1-[3-(1-methoxyethyl)phenyl]-3-[(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]urea (PubChem CID 102559364) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-[3-(1-methoxyethyl)phenyl]-3-[(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]urea.
| Compound Name | 1-[3-(1-methoxyethyl)phenyl]-3-[(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 102559364 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[3-(1-methoxyethyl)phenyl]-3-[(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]urea |
| SMILES | COC(C)c1cccc(NC(=O)NCc2n[nH]c(=S)n2C(C)C)c1 |
| InChI | InChI=1S/C16H23N5O2S/c1-10(2)21-14(19-20-16(21)24)9-17-15(22)18-13-7-5-6-12(8-13)11(3)23-4/h5-8,10-11H,9H2,1-4H3,(H,20,24)(H2,17,18,22) |
| InChIKey | AIXOHZTYBCSXLD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|