C14H19N5O2S — CID 99564755
1-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[3-(methoxymethyl)phenyl]urea (PubChem CID 99564755) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 1-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[3-(methoxymethyl)phenyl]urea.
| Compound Name | 1-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[3-(methoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 99564755 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[3-(methoxymethyl)phenyl]urea |
| SMILES | CCn1c(CNC(=O)Nc2cccc(COC)c2)n[nH]c1=S |
| InChI | InChI=1S/C14H19N5O2S/c1-3-19-12(17-18-14(19)22)8-15-13(20)16-11-6-4-5-10(7-11)9-21-2/h4-7H,3,8-9H2,1-2H3,(H,18,22)(H2,15,16,20) |
| InChIKey | MYDWXOPNWASFEH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|