C19H21N5O4S2 — CID 56543652
N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 56543652) has the molecular formula C19H21N5O4S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 56543652 |
| Molecular Formula | C19H21N5O4S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | CCn1c(CNC(=O)c2ccc(S(=O)(=O)Nc3ccc(OC)cc3)cc2)n[nH]c1=S |
| InChI | InChI=1S/C19H21N5O4S2/c1-3-24-17(21-22-19(24)29)12-20-18(25)13-4-10-16(11-5-13)30(26,27)23-14-6-8-15(28-2)9-7-14/h4-11,23H,3,12H2,1-2H3,(H,20,25)(H,22,29) |
| InChIKey | CPFATFGYMOIRGG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|