C21H24N4O2S — CID 5056811
4-tert-butyl-N-[[4-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 5056811) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[[4-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[4-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 5056811 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-tert-butyl-N-[[4-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | COc1ccc(-n2c(CNC(=O)c3ccc(C(C)(C)C)cc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-21(2,3)15-7-5-14(6-8-15)19(26)22-13-18-23-24-20(28)25(18)16-9-11-17(27-4)12-10-16/h5-12H,13H2,1-4H3,(H,22,26)(H,24,28) |
| InChIKey | IWFXXNVHSYBBNJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|