C21H29N3O3 — CID 102559378
[4-[2-(2-oxocyclohexyl)azepane-1-carbonyl]phenyl]methylurea (PubChem CID 102559378) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is [4-[2-(2-oxocyclohexyl)azepane-1-carbonyl]phenyl]methylurea.
| Compound Name | [4-[2-(2-oxocyclohexyl)azepane-1-carbonyl]phenyl]methylurea |
|---|---|
| PubChem CID | 102559378 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | [4-[2-(2-oxocyclohexyl)azepane-1-carbonyl]phenyl]methylurea |
| SMILES | NC(=O)NCc1ccc(C(=O)N2CCCCCC2C2CCCCC2=O)cc1 |
| InChI | InChI=1S/C21H29N3O3/c22-21(27)23-14-15-9-11-16(12-10-15)20(26)24-13-5-1-2-7-18(24)17-6-3-4-8-19(17)25/h9-12,17-18H,1-8,13-14H2,(H3,22,23,27) |
| InChIKey | AGEGEORGUFFEPS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |