C22H26N2O3S — CID 102560066
2-[1-[3-(1,3-thiazol-2-yloxy)benzoyl]azepan-2-yl]cyclohexan-1-one (PubChem CID 102560066) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-[1-[3-(1,3-thiazol-2-yloxy)benzoyl]azepan-2-yl]cyclohexan-1-one.
| Compound Name | 2-[1-[3-(1,3-thiazol-2-yloxy)benzoyl]azepan-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102560066 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[1-[3-(1,3-thiazol-2-yloxy)benzoyl]azepan-2-yl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1C1CCCCCN1C(=O)c1cccc(Oc2nccs2)c1 |
| InChI | InChI=1S/C22H26N2O3S/c25-20-11-4-3-9-18(20)19-10-2-1-5-13-24(19)21(26)16-7-6-8-17(15-16)27-22-23-12-14-28-22/h6-8,12,14-15,18-19H,1-5,9-11,13H2 |
| InChIKey | ROCBGWYRBGOKJX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |