C14H16F3N3OS — CID 102561454
3-[1-[4-(dimethylamino)phenyl]imidazol-2-yl]sulfanyl-1,1,1-trifluoropropan-2-ol (PubChem CID 102561454) has the molecular formula C14H16F3N3OS and a molecular weight of 331.36 g/mol. Its IUPAC name is 3-[1-[4-(dimethylamino)phenyl]imidazol-2-yl]sulfanyl-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[1-[4-(dimethylamino)phenyl]imidazol-2-yl]sulfanyl-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 102561454 |
| Molecular Formula | C14H16F3N3OS |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[1-[4-(dimethylamino)phenyl]imidazol-2-yl]sulfanyl-1,1,1-trifluoropropan-2-ol |
| SMILES | CN(C)c1ccc(-n2ccnc2SCC(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3N3OS/c1-19(2)10-3-5-11(6-4-10)20-8-7-18-13(20)22-9-12(21)14(15,16)17/h3-8,12,21H,9H2,1-2H3 |
| InChIKey | DBWABAPHCHBKRN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|