C16H25N3O4 — CID 102561694
4-butyl-N-[2-(furan-2-carbonylamino)ethyl]morpholine-3-carboxamide (PubChem CID 102561694) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-butyl-N-[2-(furan-2-carbonylamino)ethyl]morpholine-3-carboxamide.
| Compound Name | 4-butyl-N-[2-(furan-2-carbonylamino)ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 102561694 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 4-butyl-N-[2-(furan-2-carbonylamino)ethyl]morpholine-3-carboxamide |
| SMILES | CCCCN1CCOCC1C(=O)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H25N3O4/c1-2-3-8-19-9-11-22-12-13(19)15(20)17-6-7-18-16(21)14-5-4-10-23-14/h4-5,10,13H,2-3,6-9,11-12H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | BFIHUCFKPCUABF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|