C19H20ClN3O4 — CID 102561958
3-(2-chlorophenyl)-4-[2-(oxan-4-yl)-1,3-oxazole-4-carbonyl]piperazin-2-one (PubChem CID 102561958) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-[2-(oxan-4-yl)-1,3-oxazole-4-carbonyl]piperazin-2-one.
| Compound Name | 3-(2-chlorophenyl)-4-[2-(oxan-4-yl)-1,3-oxazole-4-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 102561958 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 3-(2-chlorophenyl)-4-[2-(oxan-4-yl)-1,3-oxazole-4-carbonyl]piperazin-2-one |
| SMILES | O=C1NCCN(C(=O)c2coc(C3CCOCC3)n2)C1c1ccccc1Cl |
| InChI | InChI=1S/C19H20ClN3O4/c20-14-4-2-1-3-13(14)16-17(24)21-7-8-23(16)19(25)15-11-27-18(22-15)12-5-9-26-10-6-12/h1-4,11-12,16H,5-10H2,(H,21,24) |
| InChIKey | AGFJUIDYNHNAGA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |