C15H15ClN4O2 — CID 99628590
(3R)-3-(2-chlorophenyl)-4-(2-methylpyrazole-3-carbonyl)piperazin-2-one (PubChem CID 99628590) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is (3R)-3-(2-chlorophenyl)-4-(2-methylpyrazole-3-carbonyl)piperazin-2-one.
| Compound Name | (3R)-3-(2-chlorophenyl)-4-(2-methylpyrazole-3-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 99628590 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (3R)-3-(2-chlorophenyl)-4-(2-methylpyrazole-3-carbonyl)piperazin-2-one |
| SMILES | Cn1nccc1C(=O)N1CCNC(=O)[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN4O2/c1-19-12(6-7-18-19)15(22)20-9-8-17-14(21)13(20)10-4-2-3-5-11(10)16/h2-7,13H,8-9H2,1H3,(H,17,21)/t13-/m1/s1 |
| InChIKey | DENVWTQZVXDCGR-CYBMUJFWSA-N |
| XLogP | 1.39 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |