C14H15ClN2O4 — CID 122066378
3-[2-(2-chlorophenyl)-3-oxopiperazin-1-yl]-2-methyl-3-oxopropanoic acid (PubChem CID 122066378) has the molecular formula C14H15ClN2O4 and a molecular weight of 310.74 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)-3-oxopiperazin-1-yl]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[2-(2-chlorophenyl)-3-oxopiperazin-1-yl]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122066378 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-[2-(2-chlorophenyl)-3-oxopiperazin-1-yl]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)N1CCNC(=O)C1c1ccccc1Cl |
| InChI | InChI=1S/C14H15ClN2O4/c1-8(14(20)21)13(19)17-7-6-16-12(18)11(17)9-4-2-3-5-10(9)15/h2-5,8,11H,6-7H2,1H3,(H,16,18)(H,20,21) |
| InChIKey | CWMLIAKWGZIBLB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|