C25H27N3O4S — CID 1025638
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-(butanoylamino)benzamide (PubChem CID 1025638) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-(butanoylamino)benzamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-(butanoylamino)benzamide |
|---|---|
| PubChem CID | 1025638 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-(butanoylamino)benzamide |
| SMILES | CCCC(=O)Nc1cccc(C(=O)Nc2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H27N3O4S/c1-3-8-24(29)26-22-12-7-11-20(17-22)25(30)27-21-13-15-23(16-14-21)33(31,32)28(2)18-19-9-5-4-6-10-19/h4-7,9-17H,3,8,18H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | KZRFEUKDAZEOLH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |