C25H23N3O5S — CID 31493862
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 31493862) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 31493862 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=O)c2cccc(N3C(=O)CCC3=O)c2)cc1 |
| InChI | InChI=1S/C25H23N3O5S/c1-27(17-18-6-3-2-4-7-18)34(32,33)22-12-10-20(11-13-22)26-25(31)19-8-5-9-21(16-19)28-23(29)14-15-24(28)30/h2-13,16H,14-15,17H2,1H3,(H,26,31) |
| InChIKey | FZKHNWUXOARPIC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|