C19H26N2OS — CID 102563995
1-[3-methyl-4-[(4-phenylthiophen-2-yl)methyl]piperazin-1-yl]propan-2-ol (PubChem CID 102563995) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is 1-[3-methyl-4-[(4-phenylthiophen-2-yl)methyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[3-methyl-4-[(4-phenylthiophen-2-yl)methyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 102563995 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[3-methyl-4-[(4-phenylthiophen-2-yl)methyl]piperazin-1-yl]propan-2-ol |
| SMILES | CC(O)CN1CCN(Cc2cc(-c3ccccc3)cs2)C(C)C1 |
| InChI | InChI=1S/C19H26N2OS/c1-15-11-20(12-16(2)22)8-9-21(15)13-19-10-18(14-23-19)17-6-4-3-5-7-17/h3-7,10,14-16,22H,8-9,11-13H2,1-2H3 |
| InChIKey | PMSDPOZWLQWJKT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |