C16H17NO2S — CID 122038662
(2S)-1-[(4-phenylthiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122038662) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is (2S)-1-[(4-phenylthiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(4-phenylthiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122038662 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (2S)-1-[(4-phenylthiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1Cc1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H17NO2S/c18-16(19)15-7-4-8-17(15)10-14-9-13(11-20-14)12-5-2-1-3-6-12/h1-3,5-6,9,11,15H,4,7-8,10H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | XKORTIIPYLELAK-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |