C7H15INO+ — CID 102565198
1,1-dimethylpiperidin-1-ium-4-one;hydroiodide (PubChem CID 102565198) has the molecular formula C7H15INO+ and a molecular weight of 256.11 g/mol. Its IUPAC name is 1,1-dimethylpiperidin-1-ium-4-one;hydroiodide.
| Compound Name | 1,1-dimethylpiperidin-1-ium-4-one;hydroiodide |
|---|---|
| PubChem CID | 102565198 |
| Molecular Formula | C7H15INO+ |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1,1-dimethylpiperidin-1-ium-4-one;hydroiodide |
| SMILES | C[N+]1(C)CCC(=O)CC1.I |
| InChI | InChI=1S/C7H14NO.HI/c1-8(2)5-3-7(9)4-6-8;/h3-6H2,1-2H3;1H/q+1; |
| InChIKey | LMQPCACOOKKMHW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|