C15H17FN4O — CID 102567348
3-(3-aminopyrrolidin-1-yl)-1-[(3-fluorophenyl)methyl]pyrazin-2-one (PubChem CID 102567348) has the molecular formula C15H17FN4O and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-(3-aminopyrrolidin-1-yl)-1-[(3-fluorophenyl)methyl]pyrazin-2-one.
| Compound Name | 3-(3-aminopyrrolidin-1-yl)-1-[(3-fluorophenyl)methyl]pyrazin-2-one |
|---|---|
| PubChem CID | 102567348 |
| Molecular Formula | C15H17FN4O |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-(3-aminopyrrolidin-1-yl)-1-[(3-fluorophenyl)methyl]pyrazin-2-one |
| SMILES | NC1CCN(c2nccn(Cc3cccc(F)c3)c2=O)C1 |
| InChI | InChI=1S/C15H17FN4O/c16-12-3-1-2-11(8-12)9-20-7-5-18-14(15(20)21)19-6-4-13(17)10-19/h1-3,5,7-8,13H,4,6,9-10,17H2 |
| InChIKey | XURDNQMGJJEKBM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |