C17H20FN3O2 — CID 126791326
3-[4-[(3-fluorophenyl)methyl]-4-hydroxypiperidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 126791326) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 3-[4-[(3-fluorophenyl)methyl]-4-hydroxypiperidin-1-yl]-1-methylpyrazin-2-one.
| Compound Name | 3-[4-[(3-fluorophenyl)methyl]-4-hydroxypiperidin-1-yl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 126791326 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 3-[4-[(3-fluorophenyl)methyl]-4-hydroxypiperidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N2CCC(O)(Cc3cccc(F)c3)CC2)c1=O |
| InChI | InChI=1S/C17H20FN3O2/c1-20-10-7-19-15(16(20)22)21-8-5-17(23,6-9-21)12-13-3-2-4-14(18)11-13/h2-4,7,10-11,23H,5-6,8-9,12H2,1H3 |
| InChIKey | JYCWJQTXCQYSHP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |