C13H17Cl2NO3 — CID 102567713
2-[2-[(2,6-dichlorophenoxy)methyl]morpholin-4-yl]ethanol (PubChem CID 102567713) has the molecular formula C13H17Cl2NO3 and a molecular weight of 306.19 g/mol. Its IUPAC name is 2-[2-[(2,6-dichlorophenoxy)methyl]morpholin-4-yl]ethanol.
| Compound Name | 2-[2-[(2,6-dichlorophenoxy)methyl]morpholin-4-yl]ethanol |
|---|---|
| PubChem CID | 102567713 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[2-[(2,6-dichlorophenoxy)methyl]morpholin-4-yl]ethanol |
| SMILES | OCCN1CCOC(COc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C13H17Cl2NO3/c14-11-2-1-3-12(15)13(11)19-9-10-8-16(4-6-17)5-7-18-10/h1-3,10,17H,4-9H2 |
| InChIKey | DBQPWYUJKZTOQW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |