C27H50O3Sn — CID 10256792
ethyl 2-[(1R,2E,3aS,7aR)-3a-hydroxy-7a-methyl-2-(tributylstannylmethylidene)-1,3,4,5,6,7-hexahydroinden-1-yl]acetate (PubChem CID 10256792) has the molecular formula C27H50O3Sn and a molecular weight of 541.41 g/mol. Its IUPAC name is ethyl 2-[(1R,2E,3aS,7aR)-3a-hydroxy-7a-methyl-2-(tributylstannylmethylidene)-1,3,4,5,6,7-hexahydroinden-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,2E,3aS,7aR)-3a-hydroxy-7a-methyl-2-(tributylstannylmethylidene)-1,3,4,5,6,7-hexahydroinden-1-yl]acetate |
|---|---|
| PubChem CID | 10256792 |
| Molecular Formula | C27H50O3Sn |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | ethyl 2-[(1R,2E,3aS,7aR)-3a-hydroxy-7a-methyl-2-(tributylstannylmethylidene)-1,3,4,5,6,7-hexahydroinden-1-yl]acetate |
| SMILES | CCCC[Sn](/C=C1\C[C@@]2(O)CCCC[C@]2(C)[C@H]1CC(=O)OCC)(CCCC)CCCC |
| InChI | InChI=1S/C15H23O3.3C4H9.Sn/c1-4-18-13(16)9-12-11(2)10-15(17)8-6-5-7-14(12,15)3;3*1-3-4-2;/h2,12,17H,4-10H2,1,3H3;3*1,3-4H2,2H3;/t12-,14+,15-;;;;/m0..../s1 |
| InChIKey | NMGBBIKSUPJCLL-HWYBMOECSA-N |
| XLogP | 7.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |