C29H52O3Sn — CID 10030860
ethyl (4E,5aR,9aS)-5a-hydroxy-2-methyl-4-(tributylstannylmethylidene)-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[i]indene-3-carboxylate (PubChem CID 10030860) has the molecular formula C29H52O3Sn and a molecular weight of 567.44 g/mol. Its IUPAC name is ethyl (4E,5aR,9aS)-5a-hydroxy-2-methyl-4-(tributylstannylmethylidene)-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[i]indene-3-carboxylate.
| Compound Name | ethyl (4E,5aR,9aS)-5a-hydroxy-2-methyl-4-(tributylstannylmethylidene)-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[i]indene-3-carboxylate |
|---|---|
| PubChem CID | 10030860 |
| Molecular Formula | C29H52O3Sn |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | ethyl (4E,5aR,9aS)-5a-hydroxy-2-methyl-4-(tributylstannylmethylidene)-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[i]indene-3-carboxylate |
| SMILES | CCCC[Sn](/C=C1\C[C@]2(O)CCCC[C@@]23CC(C)C(C(=O)OCC)C13)(CCCC)CCCC |
| InChI | InChI=1S/C17H25O3.3C4H9.Sn/c1-4-20-15(18)13-11(2)9-16-7-5-6-8-17(16,19)10-12(3)14(13)16;3*1-3-4-2;/h3,11,13-14,19H,4-10H2,1-2H3;3*1,3-4H2,2H3;/t11?,13?,14?,16-,17+;;;;/m0..../s1 |
| InChIKey | BMRXNWBOTSQDDP-DUSRUMLWSA-N |
| XLogP | 7.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |