C26H48O3Sn — CID 10459552
ethyl 2-[(1R,2E,3aR,6aR)-3a-hydroxy-6a-methyl-2-(tributylstannylmethylidene)-3,4,5,6-tetrahydro-1H-pentalen-1-yl]acetate (PubChem CID 10459552) has the molecular formula C26H48O3Sn and a molecular weight of 527.38 g/mol. Its IUPAC name is ethyl 2-[(1R,2E,3aR,6aR)-3a-hydroxy-6a-methyl-2-(tributylstannylmethylidene)-3,4,5,6-tetrahydro-1H-pentalen-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,2E,3aR,6aR)-3a-hydroxy-6a-methyl-2-(tributylstannylmethylidene)-3,4,5,6-tetrahydro-1H-pentalen-1-yl]acetate |
|---|---|
| PubChem CID | 10459552 |
| Molecular Formula | C26H48O3Sn |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | ethyl 2-[(1R,2E,3aR,6aR)-3a-hydroxy-6a-methyl-2-(tributylstannylmethylidene)-3,4,5,6-tetrahydro-1H-pentalen-1-yl]acetate |
| SMILES | CCCC[Sn](/C=C1\C[C@]2(O)CCC[C@]2(C)[C@H]1CC(=O)OCC)(CCCC)CCCC |
| InChI | InChI=1S/C14H21O3.3C4H9.Sn/c1-4-17-12(15)8-11-10(2)9-14(16)7-5-6-13(11,14)3;3*1-3-4-2;/h2,11,16H,4-9H2,1,3H3;3*1,3-4H2,2H3;/t11-,13+,14+;;;;/m0..../s1 |
| InChIKey | QSPLAXJEOPDEBF-SYWIVVLBSA-N |
| XLogP | 7.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |