C25H44O2Sn — CID 11755508
(5E)-3a-hydroxy-5-(tributylstannylmethylidene)-1,2,3,4,5a,6,8,9-octahydrocyclopenta[i]inden-7-one (PubChem CID 11755508) has the molecular formula C25H44O2Sn and a molecular weight of 495.34 g/mol. Its IUPAC name is (5E)-3a-hydroxy-5-(tributylstannylmethylidene)-1,2,3,4,5a,6,8,9-octahydrocyclopenta[i]inden-7-one.
| Compound Name | (5E)-3a-hydroxy-5-(tributylstannylmethylidene)-1,2,3,4,5a,6,8,9-octahydrocyclopenta[i]inden-7-one |
|---|---|
| PubChem CID | 11755508 |
| Molecular Formula | C25H44O2Sn |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (5E)-3a-hydroxy-5-(tributylstannylmethylidene)-1,2,3,4,5a,6,8,9-octahydrocyclopenta[i]inden-7-one |
| SMILES | CCCC[Sn](/C=C1\CC2(O)CCCC23CCC(=O)CC13)(CCCC)CCCC |
| InChI | InChI=1S/C13H17O2.3C4H9.Sn/c1-9-8-13(15)5-2-4-12(13)6-3-10(14)7-11(9)12;3*1-3-4-2;/h1,11,15H,2-8H2;3*1,3-4H2,2H3; |
| InChIKey | KPQKPQNPANZCNH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |