C8H8BrNO2 — CID 102568559
5-(bromomethyl)-3-(furan-2-yl)-4,5-dihydro-1,2-oxazole (PubChem CID 102568559) has the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(furan-2-yl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(bromomethyl)-3-(furan-2-yl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 102568559 |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 5-(bromomethyl)-3-(furan-2-yl)-4,5-dihydro-1,2-oxazole |
| SMILES | BrCC1CC(c2ccco2)=NO1 |
| InChI | InChI=1S/C8H8BrNO2/c9-5-6-4-7(10-12-6)8-2-1-3-11-8/h1-3,6H,4-5H2 |
| InChIKey | GFDWRKPBIBEMPU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|