About 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid
3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 102568581) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 102568581 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)C1CC(Cc2ccccc2)=NO1 |
| InChI | InChI=1S/C11H11NO3/c13-11(14)10-7-9(12-15-10)6-8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,13,14) |
| InChIKey | FIAGCFBMENMADU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CID 102568581) is 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid is O=C(O)C1CC(Cc2ccccc2)=NO1.
What is the InChIKey of 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The InChIKey is FIAGCFBMENMADU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c13-11(14)10-7-9(12-15-10)6-8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,13,14).
What are the key properties of 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid has a molecular weight of 205.21 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 102568581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).