C13H16O5S — CID 102569112
2-ethylsulfonyl-1-(hydroxymethyl)-3-phenylcyclopropane-1-carboxylic acid (PubChem CID 102569112) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is 2-ethylsulfonyl-1-(hydroxymethyl)-3-phenylcyclopropane-1-carboxylic acid.
| Compound Name | 2-ethylsulfonyl-1-(hydroxymethyl)-3-phenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 102569112 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-ethylsulfonyl-1-(hydroxymethyl)-3-phenylcyclopropane-1-carboxylic acid |
| SMILES | CCS(=O)(=O)C1C(c2ccccc2)C1(CO)C(=O)O |
| InChI | InChI=1S/C13H16O5S/c1-2-19(17,18)11-10(9-6-4-3-5-7-9)13(11,8-14)12(15)16/h3-7,10-11,14H,2,8H2,1H3,(H,15,16) |
| InChIKey | AZPQYKROTFGSDF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |