C23H26Br2N2O4 — CID 10257080
6,8-dibromo-N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-oxochromene-3-carboxamide (PubChem CID 10257080) has the molecular formula C23H26Br2N2O4 and a molecular weight of 554.28 g/mol. Its IUPAC name is 6,8-dibromo-N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dibromo-N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 10257080 |
| Molecular Formula | C23H26Br2N2O4 |
| Molecular Weight | 554.28 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | 6,8-dibromo-N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)N(C(=O)c1cc2cc(Br)cc(Br)c2oc1=O)C1CCCCC1 |
| InChI | InChI=1S/C23H26Br2N2O4/c24-15-11-14-12-18(22(29)31-20(14)19(25)13-15)21(28)27(17-9-5-2-6-10-17)23(30)26-16-7-3-1-4-8-16/h11-13,16-17H,1-10H2,(H,26,30) |
| InChIKey | FHMMHZVLOMSMAQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.28 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|