C7H9NO3 — CID 102571206
5-cyclopropyl-5-methyl-1,3-oxazolidine-2,4-dione (PubChem CID 102571206) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 5-cyclopropyl-5-methyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-cyclopropyl-5-methyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 102571206 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 5-cyclopropyl-5-methyl-1,3-oxazolidine-2,4-dione |
| SMILES | CC1(C2CC2)OC(=O)NC1=O |
| InChI | InChI=1S/C7H9NO3/c1-7(4-2-3-4)5(9)8-6(10)11-7/h4H,2-3H2,1H3,(H,8,9,10) |
| InChIKey | CLDBHOJOKOMWNB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |