About 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one
10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one (PubChem CID 122443649) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one.
Analyze 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one?
The IUPAC name of 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one (CID 122443649) is 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one.
What is the SMILES notation for 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one?
The canonical SMILES for 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one is CC1(C)CC2CCC3CC(=O)OC32C1.
What is the InChIKey of 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one?
The InChIKey is XMRUQZSXQCKIJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-11(2)6-9-4-3-8-5-10(13)14-12(8,9)7-11/h8-9H,3-7H2,1-2H3.
What are the key properties of 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one?
10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one has a molecular weight of 194.27 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dimethyl-2-oxatricyclo[6.3.0.01,5]undecan-3-one is sourced from PubChem (CID 122443649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).