C12H17NO2 — CID 163950307
(3aR,10aR)-8-methyl-3,3a,4,5,6,6a,9,10-octahydrofuro[3,2-d]isoquinolin-2-one (PubChem CID 163950307) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (3aR,10aR)-8-methyl-3,3a,4,5,6,6a,9,10-octahydrofuro[3,2-d]isoquinolin-2-one.
| Compound Name | (3aR,10aR)-8-methyl-3,3a,4,5,6,6a,9,10-octahydrofuro[3,2-d]isoquinolin-2-one |
|---|---|
| PubChem CID | 163950307 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (3aR,10aR)-8-methyl-3,3a,4,5,6,6a,9,10-octahydrofuro[3,2-d]isoquinolin-2-one |
| SMILES | CC1=CC2CNC[C@H]3CC(=O)O[C@@]23CC1 |
| InChI | InChI=1S/C12H17NO2/c1-8-2-3-12-9(4-8)6-13-7-10(12)5-11(14)15-12/h4,9-10,13H,2-3,5-7H2,1H3/t9?,10-,12+/m1/s1 |
| InChIKey | RYSVSCWDKPCPKI-YWTFCRFGSA-N |
| XLogP | 1.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|