C11H15IO2 — CID 132525044
(3aS,6R,6aS)-6a-(iodomethyl)-6-prop-2-enyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 132525044) has the molecular formula C11H15IO2 and a molecular weight of 306.14 g/mol. Its IUPAC name is (3aS,6R,6aS)-6a-(iodomethyl)-6-prop-2-enyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aS,6R,6aS)-6a-(iodomethyl)-6-prop-2-enyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 132525044 |
| Molecular Formula | C11H15IO2 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | (3aS,6R,6aS)-6a-(iodomethyl)-6-prop-2-enyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | C=CC[C@H]1CC[C@H]2CC(=O)O[C@@]12CI |
| InChI | InChI=1S/C11H15IO2/c1-2-3-8-4-5-9-6-10(13)14-11(8,9)7-12/h2,8-9H,1,3-7H2/t8-,9-,11-/m0/s1 |
| InChIKey | VJJBCCNSGRVKKJ-QXEWZRGKSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|